2-Ethynyl-1,4-dimethylbenzene - CAS 74331-70-7
Catalog: |
BB035063 |
Product Name: |
2-Ethynyl-1,4-dimethylbenzene |
CAS: |
74331-70-7 |
Synonyms: |
2-ethynyl-1,4-dimethylbenzene |
IUPAC Name: | 2-ethynyl-1,4-dimethylbenzene |
Description: | 2-Ethynyl-1,4-dimethylbenzene (CAS# 74331-70-7) is a useful research chemical compound. |
Molecular Weight: | 130.19 |
Molecular Formula: | C10H10 |
Canonical SMILES: | CC1=CC(=C(C=C1)C)C#C |
InChI: | InChI=1S/C10H10/c1-4-10-7-8(2)5-6-9(10)3/h1,5-7H,2-3H3 |
InChI Key: | UNUIVBVNLZPXCR-UHFFFAOYSA-N |
Boiling Point: | 193-194 °C |
Purity: | 95 % |
Density: | 0.914 g/cm3 |
Appearance: | Colorless to very dark yellow liquid |
MDL: | MFCD05664209 |
LogP: | 2.28470 |
GHS Hazard Statement: | H225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids] |
Precautionary Statement: | P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P305+P351+P338, P310, P370+P378, P403+P235, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
JP-2015129098-A | Method for producing 2,7-substituted [1] benzothieno [3,2-b] [1] benzothiophene derivative | 20140106 |
JP-6188583-B2 | Method for producing 2,7-substituted [1] benzothieno [3,2-b] [1] benzothiophene derivative | 20140106 |
JP-2015078174-A | Compound production method and compound obtained by the production method | 20130913 |
JP-6505400-B2 | Method for producing compound, and compound obtained by the method | 20130913 |
KR-101543667-B1 | Optically 2-amino triazole derivatives and preparation method thereof | 20130805 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 130.078250319 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 130.078250319 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alkynes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS