2-(Ethylsulfinyl)ethanamine - CAS 56216-04-7
Catalog: |
BB029296 |
Product Name: |
2-(Ethylsulfinyl)ethanamine |
CAS: |
56216-04-7 |
Synonyms: |
2-ethylsulfinylethanamine; 2-ethylsulfinylethanamine |
IUPAC Name: | 2-ethylsulfinylethanamine |
Description: | 2-(Ethylsulfinyl)ethanamine (CAS# 56216-04-7) is a useful research chemical. |
Molecular Weight: | 121.20 |
Molecular Formula: | C4H11NOS |
Canonical SMILES: | CCS(=O)CCN |
InChI: | InChI=1S/C4H11NOS/c1-2-7(6)4-3-5/h2-5H2,1H3 |
InChI Key: | IUMHWHARDIAQMZ-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
EP-2212337-A1 | Functionalised materials and uses thereof | 20071020 |
US-2010290962-A1 | Functionalised materials and uses thereof | 20071020 |
WO-2009049911-A1 | Functionalised materials and uses thereof | 20071020 |
EP-1603904-A1 | Antibacterial 1, 3- oxazolidin -2- one derivatives | 20030320 |
US-2006079695-A1 | Antibacterial oxalidinones | 20030320 |
Complexity: | 64.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 121.05613515 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 121.05613515 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 62.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS