2-(Cyclopentyloxy)acetamide - CAS 855929-18-9
Catalog: |
BB037658 |
Product Name: |
2-(Cyclopentyloxy)acetamide |
CAS: |
855929-18-9 |
Synonyms: |
2-cyclopentyloxyacetamide; 2-cyclopentyloxyacetamide |
IUPAC Name: | 2-cyclopentyloxyacetamide |
Description: | 2-(Cyclopentyloxy)acetamide (CAS# 855929-18-9 ) is a useful research chemical. |
Molecular Weight: | 143.18 |
Molecular Formula: | C7H13NO2 |
Canonical SMILES: | C1CCC(C1)OCC(=O)N |
InChI: | InChI=1S/C7H13NO2/c8-7(9)5-10-6-3-1-2-4-6/h6H,1-5H2,(H2,8,9) |
InChI Key: | KCEPUSMOAOVWHS-UHFFFAOYSA-N |
LogP: | 1.13120 |
Publication Number | Title | Priority Date |
EP-3233841-A1 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
US-10323000-B2 | Indole derivatives and their use in neurodegenerative diseases | 20141215 |
US-10676433-B2 | Indole derivatives and their use in neurodegenerative diseases | 20141215 |
US-2016168090-A1 | Novel indole derivatives and their use in neurodegenerative diseases | 20141215 |
US-2019161447-A1 | Novel indole derivatives and their use in neurodegenerative diseases | 20141215 |
Complexity: | 119 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 143.094628657 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 143.094628657 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 52.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS