(2-Cyclopentyl-2-phenylethyl)amine - CAS 175343-28-9
Catalog: |
BB013125 |
Product Name: |
(2-Cyclopentyl-2-phenylethyl)amine |
CAS: |
175343-28-9 |
Synonyms: |
2-cyclopentyl-2-phenylethanamine |
IUPAC Name: | 2-cyclopentyl-2-phenylethanamine |
Description: | (2-Cyclopentyl-2-phenylethyl)amine (CAS# 175343-28-9) is a useful research chemical. |
Molecular Weight: | 189.30 |
Molecular Formula: | C13H19N |
Canonical SMILES: | C1CCC(C1)C(CN)C2=CC=CC=C2 |
InChI: | InChI=1S/C13H19N/c14-10-13(12-8-4-5-9-12)11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2 |
InChI Key: | NHWNEYSOKMSPAK-UHFFFAOYSA-N |
Boiling Point: | 290.9 °C at 760 mmHg |
Density: | 1.007 g/cm3 |
LogP: | 3.61940 |
Publication Number | Title | Priority Date |
AU-2015362700-A1 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
AU-2015362700-B2 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
EP-3233841-A1 | Indole and azaindoles derivatives and their use in neurodegenerative diseases | 20141215 |
US-10323000-B2 | Indole derivatives and their use in neurodegenerative diseases | 20141215 |
US-10676433-B2 | Indole derivatives and their use in neurodegenerative diseases | 20141215 |
Complexity: | 155 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.15174961 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.15174961 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS