2-Chloro-9-methyl-6-morpholino-9H-purine-8-carbaldehyde - CAS 1148003-33-1
Catalog: |
BB003434 |
Product Name: |
2-Chloro-9-methyl-6-morpholino-9H-purine-8-carbaldehyde |
CAS: |
1148003-33-1 |
Synonyms: |
2-chloro-9-methyl-6-(4-morpholinyl)-8-purinecarboxaldehyde; 2-chloro-9-methyl-6-morpholin-4-ylpurine-8-carbaldehyde |
IUPAC Name: | 2-chloro-9-methyl-6-morpholin-4-ylpurine-8-carbaldehyde |
Description: | 2-Chloro-9-methyl-6-morpholino-9H-purine-8-carbaldehyde (CAS# 1148003-33-1 ) is a useful research chemical. |
Molecular Weight: | 281.70 |
Molecular Formula: | C11H12ClN5O2 |
Canonical SMILES: | CN1C(=NC2=C1N=C(N=C2N3CCOCC3)Cl)C=O |
InChI: | InChI=1S/C11H12ClN5O2/c1-16-7(6-18)13-8-9(16)14-11(12)15-10(8)17-2-4-19-5-3-17/h6H,2-5H2,1H3 |
InChI Key: | SUTRBEZVZHHHIW-UHFFFAOYSA-N |
LogP: | 0.73080 |
Publication Number | Title | Priority Date |
AU-2016242080-A1 | 6-morpholinyl-2-pyrazolyl-9H-purine derivatives and their use as PI3K inhibitors | 20150330 |
EP-3277682-A1 | 6-morpholinyl-2-pyrazolyl-9h-purine derivatives and their use as pi3k inhibitors | 20150330 |
EP-3277682-B1 | 6-morpholinyl-2-pyrazolyl-9h-purine derivatives and their use as pi3k inhibitors | 20150330 |
ES-2733505-T3 | 6-Morpholinyl-2-pyrazolyl-9H-purine derivatives and their use as PI3K inhibitors | 20150330 |
JP-2018510146-A | 6-morpholinyl-2-pyrazolyl-9H-purine derivatives and their use as PI3K inhibitors | 20150330 |
Complexity: | 341 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 281.0679523 |
Formal Charge: | 0 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 281.0679523 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 73.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS