2-Chloro-7-fluoroquinazoline - CAS 956101-10-3
Catalog: |
BB041776 |
Product Name: |
2-Chloro-7-fluoroquinazoline |
CAS: |
956101-10-3 |
Synonyms: |
2-chloro-7-fluoroquinazoline; 2-chloro-7-fluoroquinazoline |
IUPAC Name: | 2-chloro-7-fluoroquinazoline |
Description: | 2-Chloro-7-fluoroquinazoline (CAS# 956101-10-3 ) is a useful research chemical. |
Molecular Weight: | 182.58 |
Molecular Formula: | C8H4ClFN2 |
Canonical SMILES: | C1=CC2=CN=C(N=C2C=C1F)Cl |
InChI: | InChI=1S/C8H4ClFN2/c9-8-11-4-5-1-2-6(10)3-7(5)12-8/h1-4H |
InChI Key: | FRAVNDLHGCORAY-UHFFFAOYSA-N |
Boiling Point: | 254 ℃ |
Density: | 1.447 g/cm3 |
MDL: | MFCD11518968 |
LogP: | 2.42230 |
Publication Number | Title | Priority Date |
KR-20200028939-A | ALK2 kinase inhibitors containing imidazole | 20170615 |
AU-2014212242-A1 | Amine compounds having anti-inflammatory, antifungal, antiparasitic and anticancer activity | 20130201 |
AU-2018201239-A1 | Amine compounds having anti-inflammatory, antifungal, antiparasitic and anticancer activity | 20130201 |
AU-2020200510-A1 | Amine compounds having anti-inflammatory, antifungal, antiparasitic and anticancer activity | 20130201 |
AU-2013274153-A1 | Azetidine and piperidine compounds useful as PDE10 inhibitors | 20120614 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 182.004704 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 182.004704 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS