2-Chloro-7-fluorobenzothiazole - CAS 154327-28-3
Catalog: |
BB011003 |
Product Name: |
2-Chloro-7-fluorobenzothiazole |
CAS: |
154327-28-3 |
Synonyms: |
2-chloro-7-fluoro-1,3-benzothiazole; 2-chloro-7-fluoro-1,3-benzothiazole |
IUPAC Name: | 2-chloro-7-fluoro-1,3-benzothiazole |
Description: | 2-Chloro-7-fluorobenzothiazole (CAS# 154327-28-3) is a useful research chemical. |
Molecular Weight: | 187.62 |
Molecular Formula: | C7H3ClFNS |
Canonical SMILES: | C1=CC2=C(C(=C1)F)SC(=N2)Cl |
InChI: | InChI=1S/C7H3ClFNS/c8-7-10-5-3-1-2-4(9)6(5)11-7/h1-3H |
InChI Key: | GQPCQNLKLWGDIX-UHFFFAOYSA-N |
LogP: | 3.08880 |
Publication Number | Title | Priority Date |
EP-3483149-A1 | Benzo[d]thiazole derivative or salt thereof, and pharmaceutical composition including same | 20160708 |
JP-2019520403-A | Benzo [D] thiazole derivative or salt thereof, and pharmaceutical composition containing the same | 20160708 |
KR-20180006167-A | Benzo[d]thiazole derivative or its salt and pharmaceutical composition comprising the same | 20160708 |
US-10383859-B2 | Benzo[d]thiazole derivative or salt thereof, and pharmaceutical composition including same | 20160708 |
US-2019142809-A1 | Benzo[D]Thiazole Derivative Or Salt Thereof, And Pharmaceutical Composition Including Same | 20160708 |
Complexity: | 157 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.9658761 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.9658761 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 41.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzoxazole/Benzothiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS