2-Chloro-6-(trifluoromethoxy)pyridine - CAS 1221171-70-5
Catalog: |
BB005337 |
Product Name: |
2-Chloro-6-(trifluoromethoxy)pyridine |
CAS: |
1221171-70-5 |
Synonyms: |
2-chloro-6-(trifluoromethoxy)pyridine; 2-chloro-6-(trifluoromethoxy)pyridine |
IUPAC Name: | 2-chloro-6-(trifluoromethoxy)pyridine |
Description: | 2-Chloro-6-(trifluoromethoxy)pyridine (CAS# 1221171-70-5) is used in the synthesis of anti-HCV agents. |
Molecular Weight: | 197.54 |
Molecular Formula: | C6H3ClF3NO |
Canonical SMILES: | C1=CC(=NC(=C1)Cl)OC(F)(F)F |
InChI: | InChI=1S/C6H3ClF3NO/c7-4-2-1-3-5(11-4)12-6(8,9)10/h1-3H |
InChI Key: | GZFNUCAMADABAO-UHFFFAOYSA-N |
Storage: | Inert atmosphere, Room Temperature |
MDL: | MFCD18909427 |
LogP: | 2.63360 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020264499-A1 | Irak degraders and uses thereof | 20190628 |
WO-2020150626-A1 | Imidazo[1,2-a]pyridinyl derivatives as irak4 inhibitors | 20190118 |
US-2020140411-A1 | 2-amino-n-heteroaryl-nicotinamides as nav1.8 inhibitors | 20181102 |
WO-2020092187-A1 | 2-amino-n-phenyl-nicotinamides as nav1.8 inhibitors | 20181102 |
WO-2020092667-A1 | 2-amino-n-heteroaryl-nicotinamides as nav1.8 inhibitors | 20181102 |
Complexity: | 152 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 196.9855259 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 196.9855259 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 22.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS