2-Chloro-6-methoxy-4-pyridinamine - CAS 1008304-85-5
Catalog: |
BB000351 |
Product Name: |
2-Chloro-6-methoxy-4-pyridinamine |
CAS: |
1008304-85-5 |
Synonyms: |
2-chloro-6-methoxy-4-pyridinamine; 2-chloro-6-methoxypyridin-4-amine |
IUPAC Name: | 2-chloro-6-methoxypyridin-4-amine |
Description: | 2-Chloro-6-methoxy-4-pyridinamine (CAS# 1008304-85-5) is a useful research chemical. |
Molecular Weight: | 158.59 |
Molecular Formula: | C6H7ClN2O |
Canonical SMILES: | COC1=NC(=CC(=C1)N)Cl |
InChI: | InChI=1S/C6H7ClN2O/c1-10-6-3-4(8)2-5(7)9-6/h2-3H,1H3,(H2,8,9) |
InChI Key: | FZGUZYNTDPJNLS-UHFFFAOYSA-N |
LogP: | 1.90700 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021174170-A1 | Pyridazine dervatives for modulating nucleic acid splicing | 20200228 |
CN-111072554-A | Synthesis method of 4-bromo-2-chloro-6-methoxypyridine | 20191230 |
WO-2020126968-A2 | Urea derivatives | 20181220 |
AU-2018321135-A1 | Azaindolylpyridone and diazaindolylpyridone compounds | 20170823 |
CA-3072861-A1 | Azaindolylpyridone and diazaindolylpyridone compounds | 20170823 |
Complexity: | 112 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 158.0246905 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 158.0246905 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 48.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS