2-Chloro-6-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one - CAS 1440519-73-2
Catalog: |
BB009715 |
Product Name: |
2-Chloro-6-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one |
CAS: |
1440519-73-2 |
Synonyms: |
2-chloro-6-[(4-methoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one; 2-chloro-6-[(4-methoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
IUPAC Name: | 2-chloro-6-[(4-methoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
Description: | 2-Chloro-6-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one (CAS# 1440519-73-2) is a useful research chemical. |
Molecular Weight: | 288.73 |
Molecular Formula: | C15H13ClN2O2 |
Canonical SMILES: | COC1=CC=C(C=C1)CN2CC3=C(C2=O)C=CC(=N3)Cl |
InChI: | InChI=1S/C15H13ClN2O2/c1-20-11-4-2-10(3-5-11)8-18-9-13-12(15(18)19)6-7-14(16)17-13/h2-7H,8-9H2,1H3 |
InChI Key: | VRKYIOICHNNDBW-UHFFFAOYSA-N |
LogP: | 2.83750 |
Publication Number | Title | Priority Date |
US-2017121339-A1 | Pyrrolo-, pyrazolo-, imidazo-pyrimidine and pyridine compounds that inhibit mnk1 and mnk2 | 20151029 |
WO-2017075412-A1 | Pyrrolo-, pyrazolo-, imidazo-pyrimidine and pyridine compounds that inhibit mnk1 and mnk2 | 20151029 |
AU-2015330141-A1 | Spirodiamine derivatives as aldosterone synthase inhibitors | 20141008 |
AU-2015330141-B2 | Spirodiamine derivatives as aldosterone synthase inhibitors | 20141008 |
EP-3204383-A1 | Spirodiamine derivatives as aldosterone synthase inhibitors | 20141008 |
Complexity: | 358 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 288.0665554 |
Formal Charge: | 0 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 288.0665554 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 42.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS