2-Chloro-5-methylnicotinaldehyde - CAS 92444-99-0
Catalog: |
BB040515 |
Product Name: |
2-Chloro-5-methylnicotinaldehyde |
CAS: |
92444-99-0 |
Synonyms: |
2-chloro-5-methylpyridine-3-carbaldehyde |
IUPAC Name: | 2-chloro-5-methylpyridine-3-carbaldehyde |
Description: | 2-Chloro-5-methylnicotinaldehyde (CAS# 92444-99-0) is a useful research chemical. |
Molecular Weight: | 155.58 |
Molecular Formula: | C7H6ClNO |
Canonical SMILES: | CC1=CN=C(C(=C1)C=O)Cl |
InChI: | InChI=1S/C7H6ClNO/c1-5-2-6(4-10)7(8)9-3-5/h2-4H,1H3 |
InChI Key: | IZDJJYRXECMSLX-UHFFFAOYSA-N |
Boiling Point: | 265.511 °C at 760 mmHg |
Density: | 1.27 g/cm3 |
MDL: | MFCD07375370 |
LogP: | 1.85590 |
Publication Number | Title | Priority Date |
AU-2017350689-A1 | Fused bicylic pyridine compounds and their use as AMPA receptor modulators | 20161026 |
CA-3039676-A1 | Fused bicylic pyridine compounds and their use as ampa receptor modulators | 20161026 |
EP-3532477-A1 | Fused bicylic pyridine compounds and their use as ampa receptor modulators | 20161026 |
JP-2019536760-A | Fused bicyclic pyridine compounds and their use as AMPA receptor modulators | 20161026 |
KR-20190067239-A | Fused bicyclic pyridine compounds and their use as AMPA receptor modulators | 20161026 |
PMID | Publication Date | Title | Journal |
21580363 | 20100213 | (E)-1-[(2-Chloro-5-methyl-pyridin-3-yl)methyl-ene]thiosemicarbazide | Acta crystallographica. Section E, Structure reports online |
19647904 | 20091101 | Synthesis, photochemical E (trans)-->Z (cis) isomerization and antimicrobial activity of 2-chloro-5-methylpyridine-3-olefin derivatives | European journal of medicinal chemistry |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 155.0137915 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 155.0137915 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 30 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS