2-Chloro-5-iodopyridine - CAS 69045-79-0
Catalog: |
BB033680 |
Product Name: |
2-Chloro-5-iodopyridine |
CAS: |
69045-79-0 |
Synonyms: |
2-chloro-5-iodopyridine |
IUPAC Name: | 2-chloro-5-iodopyridine |
Description: | 2-Chloro-5-iodopyridine (CAS# 69045-79-0) is a useful research chemical. |
Molecular Weight: | 239.44 |
Molecular Formula: | C5H3ClIN |
Canonical SMILES: | C1=CC(=NC=C1I)Cl |
InChI: | InChI=1S/C5H3ClIN/c6-5-2-1-4(7)3-8-5/h1-3H |
InChI Key: | QWLGCWXSNYKKDO-UHFFFAOYSA-N |
Boiling Point: | 253.2 ℃ at 760 mmHg |
Density: | 2.052 g/cm3 |
MDL: | MFCD01863635 |
LogP: | 2.33960 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3901152-A1 | Kv3 enhancers for the treatment of cognitive disorders | 20200423 |
WO-2021210650-A1 | Aryl or heteroaryl derivative | 20200416 |
WO-2021188938-A1 | Phd inhibitor compounds, compositions, and use | 20200320 |
WO-2021188944-A1 | Phd inhibitor compounds, compositions, and their use | 20200320 |
JP-2021143175-A | Pharmaceutical composition containing an imidazolipyridinone compound | 20200312 |
PMID | Publication Date | Title | Journal |
17665955 | 20070831 | Modular and practical synthesis of 6-substituted pyridin-3-yl C-nucleosides | The Journal of organic chemistry |
Complexity: | 78.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 238.89987 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 238.89987 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS