2-Chloro-4-isopropylpyridine - CAS 959020-16-7
Catalog: |
BB041875 |
Product Name: |
2-Chloro-4-isopropylpyridine |
CAS: |
959020-16-7 |
Synonyms: |
2-chloro-4-propan-2-ylpyridine; 2-chloro-4-propan-2-ylpyridine |
IUPAC Name: | 2-chloro-4-propan-2-ylpyridine |
Description: | 2-Chloro-4-isopropylpyridine (CAS# 959020-16-7) is a building block used for the synthesis of various compounds having therapeutic properties. |
Molecular Weight: | 155.62 |
Molecular Formula: | C8H10ClN |
Canonical SMILES: | CC(C)C1=CC(=NC=C1)Cl |
InChI: | InChI=1S/C8H10ClN/c1-6(2)7-3-4-10-8(9)5-7/h3-6H,1-2H3 |
InChI Key: | VCQGGRUPKXCGJN-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 °C |
LogP: | 2.85840 |
Publication Number | Title | Priority Date |
CN-112321494-A | Method for preparing 2-chloro-4-isopropylpyridine | 20201117 |
US-2021188845-A1 | Substituted bicyclic compounds useful as t cell activators | 20191223 |
WO-2021133750-A1 | Substituted bicyclic piperidine derivatives useful as t cell activators | 20191223 |
WO-2021102332-A1 | Tgfbetar2 inhibitor-lrrc15 antibody conjugates and uses thereof | 20191122 |
US-2020299304-A1 | Anthelmintic aza-benzothiophene and aza-benzofuran compounds | 20190319 |
Complexity: | 103 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 155.050177 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 155.050177 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS