2-Chloro-4-iodo-6-(trifluoromethyl)pyridine - CAS 205444-22-0
Catalog: |
BB016053 |
Product Name: |
2-Chloro-4-iodo-6-(trifluoromethyl)pyridine |
CAS: |
205444-22-0 |
Synonyms: |
2-chloro-4-iodo-6-(trifluoromethyl)pyridine; 2-chloro-4-iodo-6-(trifluoromethyl)pyridine |
IUPAC Name: | 2-chloro-4-iodo-6-(trifluoromethyl)pyridine |
Description: | 2-Chloro-4-iodo-6-(trifluoromethyl)pyridine (CAS# 205444-22-0) is a useful research chemical. |
Molecular Weight: | 307.44 |
Molecular Formula: | C6H2ClF3IN |
Canonical SMILES: | C1=C(C=C(N=C1C(F)(F)F)Cl)I |
InChI: | InChI=1S/C6H2ClF3IN/c7-5-2-3(11)1-4(12-5)6(8,9)10/h1-2H |
InChI Key: | JHKQSKCFLAXPKK-UHFFFAOYSA-N |
Boiling Point: | 230.469 °C at 760 mmHg |
Density: | 2.047 g/cm3 |
MDL: | MFCD10699394 |
LogP: | 3.35840 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021134004-A1 | Cyclic compounds and methods of using same | 20191227 |
WO-2021123291-A1 | Oga inhibitor compounds | 20191218 |
WO-2021094312-A1 | Pyrrolidine and bicycloheteroaryl containing oga inhibitor compounds | 20191111 |
US-2021139517-A1 | Bicyclic heteroaryl compounds and uses thereof | 20191108 |
WO-2021092115-A1 | Bicyclic heteroaryl compounds and uses thereof | 20191108 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 306.88726 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 306.88726 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS