2-Chloro-4-fluoro-5-nitroanisole - CAS 84478-76-2
Catalog: |
BB037214 |
Product Name: |
2-Chloro-4-fluoro-5-nitroanisole |
CAS: |
84478-76-2 |
Synonyms: |
1-chloro-5-fluoro-2-methoxy-4-nitrobenzene; 1-chloro-5-fluoro-2-methoxy-4-nitrobenzene |
IUPAC Name: | 1-chloro-5-fluoro-2-methoxy-4-nitrobenzene |
Description: | 2-Chloro-4-fluoro-5-nitroanisole (CAS# 84478-76-2) is a useful research chemical. |
Molecular Weight: | 205.57 |
Molecular Formula: | C7H5ClFNO3 |
Canonical SMILES: | COC1=C(C=C(C(=C1)[N+](=O)[O-])F)Cl |
InChI: | InChI=1S/C7H5ClFNO3/c1-13-7-3-6(10(11)12)5(9)2-4(7)8/h2-3H,1H3 |
InChI Key: | CRONHBXGPYQWHX-UHFFFAOYSA-N |
Boiling Point: | 307.9 °C at 760 mmHg |
Density: | 1.453 g/cm3 |
MDL: | MFCD03425810 |
LogP: | 2.91910 |
Publication Number | Title | Priority Date |
CA-3049643-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
JP-2020506197-A | Novel heterocyclic compound, production method thereof and pharmaceutical composition containing the same | 20170207 |
KR-102084772-B1 | Novel hetero-ring compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
KR-20180091770-A | Novel hetero-ring compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
TW-201831463-A | Novel heterocyclic compound, preparation method thereof and pharmaceutical composition containing the same | 20170207 |
Complexity: | 199 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.9941989 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.9941989 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS