2-Chloro-4,5-dimethylpyridine - CAS 343268-69-9
Catalog: |
BB062324 |
Product Name: |
2-Chloro-4,5-dimethylpyridine |
CAS: |
343268-69-9 |
Synonyms: |
2-Chloro-4,5-dimethylpyridine; Pyridine, 2-chloro-4,5-dimethyl- |
IUPAC Name: | 2-chloro-4,5-dimethylpyridine |
Description: | 2-Chloro-4,5-dimethylpyridine is a trisubstituted pyridine used in the preparation of MCH receptor antagonists. |
Molecular Weight: | 141.6 |
Molecular Formula: | C7H8ClN |
Canonical SMILES: | CC1=CC(=NC=C1C)Cl |
InChI: | InChI=1S/C7H8ClN/c1-5-3-7(8)9-4-6(5)2/h3-4H,1-2H3 |
InChI Key: | UIUDRIPPDPPWRR-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2021399237-A1 | Organic electroluminescent materials and devices | 20200602 |
WO-2021110656-A1 | Oga inhibitor compounds | 20191202 |
WO-2020147705-A1 | 4-pyridinyl formamide compound or derivative thereof, preparation method therefor, herbicidal composition and use thereof | 20190114 |
KR-20200030002-A | Organic electroluminescent materials and devices | 20180910 |
US-2020083459-A1 | Organic electroluminescent materials and devices | 20180910 |
WO-2019243530-A1 | Oga inhibitor compounds | 20180620 |
AU-2019289971-A1 | OGA inhibitor compounds | 20180620 |
TW-202016118-A | OGA inhibitor compounds | 20180620 |
CA-3103758-A1 | Oga inhibitor compounds | 20180620 |
CN-112292381-A | OGA inhibitor compounds | 20180620 |
Complexity: | 94.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 141.034527 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 141.034527 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS