2-Chloro-3-fluorotoluene - CAS 116850-28-3
Catalog: |
BB003817 |
Product Name: |
2-Chloro-3-fluorotoluene |
CAS: |
116850-28-3 |
Synonyms: |
2-chloro-1-fluoro-3-methylbenzene; 2-chloro-1-fluoro-3-methylbenzene |
IUPAC Name: | 2-chloro-1-fluoro-3-methylbenzene |
Description: | 2-Chloro-3-fluorotoluene (CAS# 116850-28-3) is a useful research chemical. |
Molecular Weight: | 144.57 |
Molecular Formula: | C7H6ClF |
Canonical SMILES: | CC1=C(C(=CC=C1)F)Cl |
InChI: | InChI=1S/C7H6ClF/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3 |
InChI Key: | YSCFYJSLWLBAND-UHFFFAOYSA-N |
Boiling Point: | 164.4 °C at 760 mmHg |
Density: | 1.186 g/cm3 |
LogP: | 2.78750 |
Publication Number | Title | Priority Date |
WO-2021110009-A1 | Novel aurora kinase inhibitor and use thereof | 20191203 |
WO-2021063346-A1 | Kras g12c inhibitor and application thereof | 20190930 |
WO-2021043322-A1 | Azepino pyrimidine derivatives and medical use thereof | 20190906 |
WO-2020112581-A1 | Novel substituted piperazine amide compounds as indoleamine 2, 3-dioxygenase (ido) inhibitors | 20181128 |
EP-3886845-A1 | Novel substituted piperazine amide compounds as indoleamine 2, 3-dioxygenase (ido) inhibitors | 20181128 |
Complexity: | 94.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 144.014206 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 144.014206 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS