2-Bromophenylacetyl chloride - CAS 55116-09-1
Catalog: |
BB028917 |
Product Name: |
2-Bromophenylacetyl chloride |
CAS: |
55116-09-1 |
Synonyms: |
2-(2-bromophenyl)acetyl chloride |
IUPAC Name: | 2-(2-bromophenyl)acetyl chloride |
Description: | 2-Bromophenylacetyl chloride (CAS# 55116-09-1 ) is a useful research chemical. |
Molecular Weight: | 233.49 |
Molecular Formula: | C8H6BrClO |
Canonical SMILES: | C1=CC=C(C(=C1)CC(=O)Cl)Br |
InChI: | InChI=1S/C8H6BrClO/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2 |
InChI Key: | RFPBUXOVSZEMSW-UHFFFAOYSA-N |
Boiling Point: | 186 °C (lit.) |
Density: | 1.57 g/cm3 |
Appearance: | Solid |
MDL: | MFCD01863517 |
LogP: | 2.75700 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111153865-A | Parecoxib sodium substituted impurity and preparation method thereof | 20200119 |
US-2020397797-A1 | Heterocyclic compounds | 20190606 |
WO-2020247504-A1 | Heterocyclic compounds | 20190606 |
CN-111512223-A | Electrophoretic display device and electronic apparatus | 20171222 |
US-2020058881-A1 | Nitrogen-containing heterocyclic compounds for organic light emitting devices | 20161229 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 231.92906 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 231.92906 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS