2-(Bromomethyl)benzyl alcohol - CAS 74785-02-7
Catalog: |
BB035161 |
Product Name: |
2-(Bromomethyl)benzyl alcohol |
CAS: |
74785-02-7 |
Synonyms: |
[2-(bromomethyl)phenyl]methanol |
IUPAC Name: | [2-(bromomethyl)phenyl]methanol |
Description: | 2-(Bromomethyl)benzyl alcohol (CAS# 74785-02-7) is a useful research chemical. |
Molecular Weight: | 201.06 |
Molecular Formula: | C8H9BrO |
Canonical SMILES: | C1=CC=C(C(=C1)CO)CBr |
InChI: | InChI=1S/C8H9BrO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2 |
InChI Key: | JDBQNNKIOFSPOA-UHFFFAOYSA-N |
Boiling Point: | 279.551 °C at 760 mmHg |
Density: | 1.515 g/cm3 |
MDL: | MFCD08457642 |
LogP: | 2.07380 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P272, P280, P301+P312, P301+P330+P331, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P330, P333+P313, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021158707-A1 | Methods and compounds for the treatment of genetic disease | 20200203 |
WO-2017099237-A1 | Aminoazole derivative | 20151211 |
AU-2016341259-A1 | Pyridone derivatives and their use as kinase inhibitors | 20151022 |
AU-2016341259-B2 | Pyridone derivatives and their use as kinase inhibitors | 20151022 |
US-2018305331-A1 | Pyridone derivatives and their use as kinase inhibitors | 20151022 |
Complexity: | 95.3 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 199.98368 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 199.98368 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 20.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxygen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS