2-(Bromomethyl)-6-fluoropyridine - CAS 100202-78-6
Catalog: |
BB000127 |
Product Name: |
2-(Bromomethyl)-6-fluoropyridine |
CAS: |
100202-78-6 |
Synonyms: |
2-(bromomethyl)-6-fluoropyridine; 2-(bromomethyl)-6-fluoropyridine |
IUPAC Name: | 2-(bromomethyl)-6-fluoropyridine |
Description: | 2-(Bromomethyl)-6-fluoropyridine (CAS# 100202-78-6) is a useful research chemical. |
Molecular Weight: | 190.01 |
Molecular Formula: | C6H5BrFN |
Canonical SMILES: | C1=CC(=NC(=C1)F)CBr |
InChI: | InChI=1S/C6H5BrFN/c7-4-5-2-1-3-6(8)9-5/h1-3H,4H2 |
InChI Key: | ADYKBYXVMBDQQX-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 °C |
LogP: | 2.11560 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P310, P312, P321, P322, P330, P332+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2019205147-A1 | Amino acetamide compound containing benzo oxygen-containing aliphatic ring structure and use thereof | 20180428 |
CN-112041296-A | Aminoacetamides containing benzo-oxy-alicyclic structure and use thereof | 20180428 |
DE-102017125533-A1 | 4- (Furan-2-yl) -1H-pyrazolo [3,4-d] pyrimidin-6-amine derivatives and their use | 20171031 |
WO-2019086074-A1 | 4-(furan-2-yl)-1h-pyrazolo[3,4-d]pyrimidin-6-amine derivative and use thereof | 20171031 |
AU-2018277958-A1 | 6h-thieno(2,3-e)(1,2,4)triazolo(3,4-c)(1,2,4)triazepine derivative | 20170531 |
PMID | Publication Date | Title | Journal |
14966993 | 20040223 | Easy preparation of the tris(2-fluoro-6-pyridylmethyl)amine ligand and instantaneous reaction of the corresponding dichloroferrous complex with molecular dioxygen: new access to dinuclear species | Inorganic chemistry |
Complexity: | 89.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 188.95894 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 188.95894 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS