2-Bromo-N-methylbenzylamine - CAS 698-19-1
Catalog: |
BB033983 |
Product Name: |
2-Bromo-N-methylbenzylamine |
CAS: |
698-19-1 |
Synonyms: |
1-(2-bromophenyl)-N-methylmethanamine |
IUPAC Name: | 1-(2-bromophenyl)-N-methylmethanamine |
Description: | 2-Bromo-N-methylbenzylamine (CAS# 698-19-1) is a useful research chemical. |
Molecular Weight: | 200.08 |
Molecular Formula: | C8H10BrN |
Canonical SMILES: | CNCC1=CC=CC=C1Br |
InChI: | InChI=1S/C8H10BrN/c1-10-6-7-4-2-3-5-8(7)9/h2-5,10H,6H2,1H3 |
InChI Key: | TUADRPBKJHMHDH-UHFFFAOYSA-N |
Boiling Point: | 71-74 °C (2 mmHg) |
Purity: | 95 % |
Density: | 1.358 g/cm3 |
Appearance: | Colorless to tan liquid |
MDL: | MFCD05262953 |
LogP: | 2.55940 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P330, P337+P313, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3309146-A1 | Sulfonamide derivative and pharmaceutically acceptable acid addition salt thereof | 20150612 |
US-10351522-B2 | Sulfonamide derivative and pharmaceutically acceptable acid addition salt thereof | 20150612 |
US-2018179151-A1 | Sulfonamide derivative and pharmaceutically acceptable acid addition salt thereof | 20150612 |
US-2017305924-A1 | Nargenicin compounds and uses thereof as antibacterial agents | 20141022 |
US-2018186808-A1 | Nargenicin compounds and uses thereof as antibacterial agents | 20141022 |
Complexity: | 95.3 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 198.99966 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 198.99966 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 12 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS