2-Bromo-9,9-diethylfluorene - CAS 287493-15-6
Catalog: |
BB019937 |
Product Name: |
2-Bromo-9,9-diethylfluorene |
CAS: |
287493-15-6 |
Synonyms: |
2-bromo-9,9-diethylfluorene; 2-bromo-9,9-diethylfluorene |
IUPAC Name: | 2-bromo-9,9-diethylfluorene |
Description: | 2-Bromo-9,9-diethylfluorene (CAS# 287493-15-6) is a useful research chemical. |
Molecular Weight: | 301.22 |
Molecular Formula: | C17H17Br |
Canonical SMILES: | CCC1(C2=CC=CC=C2C3=C1C=C(C=C3)Br)CC |
InChI: | InChI=1S/C17H17Br/c1-3-17(4-2)15-8-6-5-7-13(15)14-10-9-12(18)11-16(14)17/h5-11H,3-4H2,1-2H3 |
InChI Key: | HJXPGCTYMKCLTR-UHFFFAOYSA-N |
Boiling Point: | 381.033 °C at 760 mmHg |
Density: | 1.265 g/cm3 |
Appearance: | Solid |
LogP: | 5.53560 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P264, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, and P362 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111825722-A | Saturated red luminescent fluorenyl benzoquinoline iridium complex | 20200703 |
CN-111848452-A | Arylamine diphenyl trans-butenedionitrile derivative with efficient undoped electroluminescence of long-wave red light | 20200703 |
KR-20210033855-A | Ultraviolet- absorbent compound and encapsulant composition comprising same | 20190919 |
KR-20190129717-A | Novel oxime ester compound and photoresist composition containing the same | 20180511 |
WO-2019216600-A1 | Novel oxime ester compound and photoresist composition comprising same | 20180511 |
Complexity: | 294 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 300.05136 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 300.05136 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 6.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS