2-Bromo-7-methoxynaphthalene - CAS 200875-36-1
Catalog: |
BB015643 |
Product Name: |
2-Bromo-7-methoxynaphthalene |
CAS: |
200875-36-1 |
Synonyms: |
2-bromo-7-methoxynaphthalene; 2-bromo-7-methoxynaphthalene |
IUPAC Name: | 2-bromo-7-methoxynaphthalene |
Description: | 2-Bromo-7-methoxynaphthalene (CAS# 200875-36-1) is a useful research chemical compound. |
Molecular Weight: | 237.09 |
Molecular Formula: | C11H9BrO |
Canonical SMILES: | COC1=CC2=C(C=C1)C=CC(=C2)Br |
InChI: | InChI=1S/C11H9BrO/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h2-7H,1H3 |
InChI Key: | JOFOVYQPOOUQHX-UHFFFAOYSA-N |
LogP: | 3.61090 |
Publication Number | Title | Priority Date |
KR-20190116947-A | Amine compound and organic light emitting device comprising same | 20180405 |
WO-2019194617-A1 | Amine compound and organic light emitting diode comprising same | 20180405 |
CN-111868028-A | Amine compound and organic light emitting device including the same | 20180405 |
US-2021057650-A1 | Amine compound and organic light emitting diode comprising same | 20180405 |
WO-2019178480-A1 | Pyrazole-containing macrophage migration inhibitory factor inhibitors | 20180315 |
Complexity: | 172 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 235.98368 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 235.98368 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 9.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS