2-Bromo-6-methylbenzoic acid - CAS 90259-31-7
Catalog: |
BB039800 |
Product Name: |
2-Bromo-6-methylbenzoic acid |
CAS: |
90259-31-7 |
Synonyms: |
2-bromo-6-methylbenzoic acid |
IUPAC Name: | 2-bromo-6-methylbenzoic acid |
Description: | 2-Bromo-6-methylbenzoic acid (CAS# 90259-31-7) is a useful research chemical. |
Molecular Weight: | 215.04 |
Molecular Formula: | C8H7BrO2 |
Canonical SMILES: | CC1=C(C(=CC=C1)Br)C(=O)O |
InChI: | InChI=1S/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
InChI Key: | ICXBPDJQFPIBSS-UHFFFAOYSA-N |
Boiling Point: | 307.043 ℃ at 760 mmHg |
Density: | 1.6 g/cm3 |
MDL: | MFCD01310788 |
LogP: | 2.45570 |
GHS Hazard Statement: | H301 (86.67%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112441907-A | Method for co-producing mono-substituted methyl benzoic acid and mono-substituted phthalic acid | 20190830 |
KR-20200138087-A | 1,3,4-Oxadiazole homophthalimide Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20190531 |
WO-2020240493-A1 | 1,3,4-oxadiazole homophthalimide derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20190531 |
WO-2020100944-A1 | Dihydropyrrolopyrazole derivative | 20181114 |
EP-3885347-A1 | Dihydropyrrolopyrazole derivative | 20181114 |
Complexity: | 158 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 213.96294 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 213.96294 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 37.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS