2-Bromo-6-iodopyridine - CAS 234111-08-1
Catalog: |
BB018046 |
Product Name: |
2-Bromo-6-iodopyridine |
CAS: |
234111-08-1 |
Synonyms: |
2-bromo-6-iodopyridine; 2-bromo-6-iodopyridine |
IUPAC Name: | 2-bromo-6-iodopyridine |
Description: | 2-Bromo-6-iodopyridine (CAS# 234111-08-1) is a useful research chemical. |
Molecular Weight: | 283.89 |
Molecular Formula: | C5H3BrIN |
Canonical SMILES: | C1=CC(=NC(=C1)I)Br |
InChI: | InChI=1S/C5H3BrIN/c6-4-2-1-3-5(7)8-4/h1-3H |
InChI Key: | KJOQMWRTNVBXEV-UHFFFAOYSA-N |
Boiling Point: | 286.7 °C at 760 mmHg |
Density: | 2.347 g/cm3 |
MDL: | MFCD08059557 |
LogP: | 2.44870 |
GHS Hazard Statement: | H302 (33.33%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113024548-A | Process for preparing 2-amino-9H-pyridine [2,3-b ] indole | 20210129 |
AU-2018360285-A1 | Novel aminopyridinemethanol compounds and their use | 20171103 |
CA-3081142-A1 | Novel aminopyridinemethanol compounds and their use | 20171103 |
WO-2019086614-A1 | Novel aminopyridinemethanol compounds and their use | 20171103 |
CN-111527068-A | Novel aminopyridine carbinol compounds and uses thereof | 20171103 |
Complexity: | 78.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 282.84936 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 282.84936 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS