2-Bromo-6-ethylpyridine - CAS 83004-13-1
Catalog: |
BB036948 |
Product Name: |
2-Bromo-6-ethylpyridine |
CAS: |
83004-13-1 |
Synonyms: |
2-bromo-6-ethylpyridine; 2-bromo-6-ethylpyridine |
IUPAC Name: | 2-bromo-6-ethylpyridine |
Description: | 2-Bromo-6-ethylpyridine (CAS# 83004-13-1) is a useful research chemical compound. |
Molecular Weight: | 186.05 |
Molecular Formula: | C7H8BrN |
Canonical SMILES: | CCC1=NC(=CC=C1)Br |
InChI: | InChI=1S/C7H8BrN/c1-2-6-4-3-5-7(8)9-6/h3-5H,2H2,1H3 |
InChI Key: | TYOSQEKDQKYBLX-UHFFFAOYSA-N |
LogP: | 2.40650 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020084492-A1 | Inhibitors of human immunodeficiency virus replication | 20181024 |
TW-202031261-A | Inhibitors of human immunodeficiency virus replication | 20181024 |
US-2020360384-A1 | Inhibitors of human immunodeficiency virus replication | 20181024 |
CN-113195475-A | Inhibitors of human immunodeficiency virus replication | 20181024 |
EP-3870577-A1 | Inhibitors of human immunodeficiency virus replication | 20181024 |
Complexity: | 85 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 184.98401 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 184.98401 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS