2-Bromo-5-nitrofuran - CAS 823-73-4
Catalog: |
BB036805 |
Product Name: |
2-Bromo-5-nitrofuran |
CAS: |
823-73-4 |
Synonyms: |
2-bromo-5-nitrofuran; 2-bromo-5-nitrofuran |
IUPAC Name: | 2-bromo-5-nitrofuran |
Description: | 2-Bromo-5-nitrofuran (CAS# 823-73-4) is a useful research chemical. |
Molecular Weight: | 191.97 |
Molecular Formula: | C4H2BrNO3 |
Canonical SMILES: | C1=C(OC(=C1)Br)[N+](=O)[O-] |
InChI: | InChI=1S/C4H2BrNO3/c5-3-1-2-4(9-3)6(7)8/h1-2H |
InChI Key: | QGTDMAKRJHGXOF-UHFFFAOYSA-N |
Boiling Point: | 118 °C / 15 mmHg |
Density: | 1.914 g/cm3 |
MDL: | MFCD00142879 |
LogP: | 2.47350 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P264, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, and P362 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2018219281-A1 | 4-pyrimidinediamine small molecular organic compounds and derivatives thereof and use thereof | 20170531 |
AU-2008282032-A1 | Novel heterocyclic compounds as mGlu5 antagonists | 20070802 |
AU-2008282032-B2 | Novel heterocyclic compounds as mGlu5 antagonists | 20070802 |
CA-2694359-A1 | Novel heterocyclic compounds as mglu5 antagonists | 20070802 |
CN-101821256-A | Novel heterocyclic compounds as mGlu5 antagonists | 20070802 |
Complexity: | 124 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 190.92181 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 190.92181 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 59 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Furans
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS