2-Bromo-5-nitrobenzonitrile - CAS 134604-07-2
Catalog: |
BB007964 |
Product Name: |
2-Bromo-5-nitrobenzonitrile |
CAS: |
134604-07-2 |
Synonyms: |
2-bromo-5-nitrobenzonitrile |
IUPAC Name: | 2-bromo-5-nitrobenzonitrile |
Description: | 2-Bromo-5-nitrobenzonitrile (CAS# 134604-07-2) is a useful research chemical. |
Molecular Weight: | 227.01 |
Molecular Formula: | C7H3BrN2O2 |
Canonical SMILES: | C1=CC(=C(C=C1[N+](=O)[O-])C#N)Br |
InChI: | InChI=1S/C7H3BrN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H |
InChI Key: | RKODNVITKISFKU-UHFFFAOYSA-N |
Boiling Point: | 321.1 ℃ at 760 mmHg |
Melting Point: | 118-120 ℃ |
Purity: | 96 % |
Density: | 1.81 g/cm3 |
Storage: | Inert atmosphere, 2-8 ℃ |
MDL: | MFCD00234249 |
LogP: | 2.75218 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
KR-20210114880-A | Diamine compound, polyimide-based polymer, polymer film, substrate for display device and optical device using the same | 20200311 |
CN-109651297-A | A kind of N- benzyl-N- aryl sulfonic acid amides analog derivative and preparation and application | 20190122 |
WO-2020151687-A1 | N-benzyl-n-arylsulfonamide derivative and preparation and use thereof | 20190122 |
KR-101970730-B1 | Azobenzen compound and composition for hologram recording comprising thereof | 20170420 |
KR-20180117828-A | Azobenzen compound and composition for hologram recording comprising thereof | 20170420 |
Complexity: | 229 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 225.93779 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 225.93779 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 69.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS