2-Bromo-5-iodotoluene - CAS 202865-85-8
Catalog: |
BB015772 |
Product Name: |
2-Bromo-5-iodotoluene |
CAS: |
202865-85-8 |
Synonyms: |
1-bromo-4-iodo-2-methylbenzene; 1-bromo-4-iodo-2-methylbenzene |
IUPAC Name: | 1-bromo-4-iodo-2-methylbenzene |
Description: | 2-Bromo-5-iodotoluene (CAS# 202865-85-8) is a useful research chemical. |
Molecular Weight: | 296.93 |
Molecular Formula: | C7H6BrI |
Canonical SMILES: | CC1=C(C=CC(=C1)I)Br |
InChI: | InChI=1S/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
InChI Key: | QSQOGKONVJDRNH-UHFFFAOYSA-N |
Boiling Point: | 148 °C / 20 mmHg |
Density: | 2.07 g/cm3 |
MDL: | MFCD00070749 |
LogP: | 3.36210 |
GHS Hazard Statement: | H315 (90.91%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
JP-2021138915-A | Arylamine-fluorene alternating copolymer, and electroluminescence element materials and electroluminescence elements using the copolymer. | 20200305 |
KR-20210105042-A | An electroluminescent compound and an electroluminescent device comprising the same | 20200218 |
US-2021128532-A1 | Heterocyclic carboxylate compounds as glycolate oxidase inhibitors | 20191101 |
WO-2021086874-A1 | Heterocyclic carboxylate compounds as glycolate oxidase inhibitors | 20191101 |
CN-110571340-A | Organic electroluminescent device and electronic apparatus | 20190823 |
Complexity: | 94.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 295.86976 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 295.86976 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS