2-Bromo-5-ethynylthiophene - CAS 105995-73-1
Catalog: |
BB001752 |
Product Name: |
2-Bromo-5-ethynylthiophene |
CAS: |
105995-73-1 |
Synonyms: |
2-bromo-5-ethynylthiophene; 2-bromo-5-ethynylthiophene |
IUPAC Name: | 2-bromo-5-ethynylthiophene |
Description: | 2-Bromo-5-ethynylthiophene (CAS# 105995-73-1) is a useful research chemical. |
Molecular Weight: | 187.06 |
Molecular Formula: | C6H3BrS |
Canonical SMILES: | C#CC1=CC=C(S1)Br |
InChI: | InChI=1S/C6H3BrS/c1-2-5-3-4-6(7)8-5/h1,3-4H |
InChI Key: | UYVDCGFLVLPESJ-UHFFFAOYSA-N |
Storage: | Keep in dark place, Sealed in dry, 2-8 ℃ |
LogP: | 2.49190 |
Publication Number | Title | Priority Date |
WO-2019146773-A1 | Thiophene derivative and use thereof | 20180125 |
AU-2019211910-A1 | Thiophene derivative and use thereof | 20180125 |
AU-2019211910-A2 | Thiophene derivative and use thereof | 20180125 |
CN-111655685-A | Thiophene derivative and use thereof | 20180125 |
EP-3744719-A1 | Thiophene derivative and use thereof | 20180125 |
PMID | Publication Date | Title | Journal |
21643609 | 20110714 | Reactivity of the 16e (p-cymene)Ru half-sandwich complex containing a chelating 1,2-dicarba-closo-dodecaborane-1,2-dithiolate ligand towards diynes | Dalton transactions (Cambridge, England : 2003) |
Complexity: | 124 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 185.91388 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 185.91388 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 28.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Thiophenes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS