2-Bromo-5-ethylpyridine - CAS 19842-08-1
Catalog: |
BB015343 |
Product Name: |
2-Bromo-5-ethylpyridine |
CAS: |
19842-08-1 |
Synonyms: |
2-bromo-5-ethylpyridine; 2-bromo-5-ethylpyridine |
IUPAC Name: | 2-bromo-5-ethylpyridine |
Description: | 2-Bromo-5-ethylpyridine (CAS# 19842-08-1) is a disubstituted pyridine used in the preparation of biologically active compounds such as potential prostacyclin receptor inhibitors. |
Molecular Weight: | 186.05 |
Molecular Formula: | C7H8BrN |
Canonical SMILES: | CCC1=CN=C(C=C1)Br |
InChI: | InChI=1S/C7H8BrN/c1-2-6-3-4-7(8)9-5-6/h3-5H,2H2,1H3 |
InChI Key: | MVXBQGHDMSEOGX-UHFFFAOYSA-N |
MDL: | MFCD11869552 |
LogP: | 2.40650 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020240586-A1 | Novel compounds for inhibition of janus kinase 1 | 20190528 |
WO-2020125627-A1 | Phenylpyrrolidine compound and use thereof | 20181218 |
CN-111333626-A | Phenyl pyrrolidine compounds and uses thereof | 20181218 |
EP-3901146-A1 | Phenylpyrrolidine compound and use thereof | 20181218 |
KR-20210093320-A | Phenylpyrrolidine-based compounds and uses thereof | 20181218 |
Complexity: | 85 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 184.98401 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 184.98401 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS