2-Bromo-4-methylbenzenesulfonyl Chloride - CAS 89794-06-9
Catalog: |
BB039601 |
Product Name: |
2-Bromo-4-methylbenzenesulfonyl Chloride |
CAS: |
89794-06-9 |
Synonyms: |
2-bromo-4-methylbenzenesulfonyl chloride; 2-bromo-4-methylbenzenesulfonyl chloride |
IUPAC Name: | 2-bromo-4-methylbenzenesulfonyl chloride |
Description: | 2-Bromo-4-methylbenzenesulfonyl Chloride (CAS# 89794-06-9) is a useful research chemical. |
Molecular Weight: | 269.54 |
Molecular Formula: | C7H6BrClO2S |
Canonical SMILES: | CC1=CC(=C(C=C1)S(=O)(=O)Cl)Br |
InChI: | InChI=1S/C7H6BrClO2S/c1-5-2-3-7(6(8)4-5)12(9,10)11/h2-4H,1H3 |
InChI Key: | NQXSKUPCOJGZQA-UHFFFAOYSA-N |
LogP: | 3.76580 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P261, P264, P271, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020109350-A1 | 3-(phenylsulfonyl)-[1,2,3]triazolo[1,5a]quinazolin-5(4h)-one derivatives | 20181128 |
CN-113166070-A | Pesticidal compounds | 20181024 |
CN-111491925-A | Pesticidal compounds | 20171221 |
CN-106458966-B | Pyrazines derivatives as inhibitors of phosphatidylinositol3 3-kinase | 20140424 |
CN-106458980-A | Amino pyridine derivatives as phosphatidylinositol 3-kinase inhibitors | 20140424 |
Complexity: | 247 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 267.89604 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 267.89604 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS