2-Bromo-4-chloropyrimidine - CAS 885702-33-0
Catalog: |
BB039014 |
Product Name: |
2-Bromo-4-chloropyrimidine |
CAS: |
885702-33-0 |
Synonyms: |
2-bromo-4-chloropyrimidine; 2-bromo-4-chloropyrimidine |
IUPAC Name: | 2-bromo-4-chloropyrimidine |
Description: | 2-Bromo-4-chloropyrimidine (CAS# 885702-33-0) is a useful research chemical. |
Molecular Weight: | 193.43 |
Molecular Formula: | C4H2BrClN2 |
Canonical SMILES: | C1=CN=C(N=C1Cl)Br |
InChI: | InChI=1S/C4H2BrClN2/c5-4-7-2-1-3(6)8-4/h1-2H |
InChI Key: | WMZFUTOHAWIHJN-UHFFFAOYSA-N |
Appearance: | Solid |
MDL: | MFCD11847634 |
LogP: | 1.89250 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021011913-A1 | Tau-protein targeting compounds and associated methods of use | 20190717 |
CN-110734436-A | Pyrimidine or pyrazine ring compounds and application thereof | 20180719 |
KR-20200139676-A | Amino acid compounds and methods of use | 20180307 |
AU-2015279377-A1 | Indolin-2-one or pyrrolo-pyridin-2-one derivatives | 20140626 |
AU-2015279377-B2 | Indolin-2-one or pyrrolo-pyridin-2-one derivatives | 20140626 |
Complexity: | 80.4 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 191.90899 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 191.90899 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS