2-Bromo-3-fluoro-6-methoxybenzaldehyde - CAS 1780200-30-7
Catalog: |
BB013376 |
Product Name: |
2-Bromo-3-fluoro-6-methoxybenzaldehyde |
CAS: |
1780200-30-7 |
Synonyms: |
2-bromo-3-fluoro-6-methoxybenzaldehyde; 2-bromo-3-fluoro-6-methoxybenzaldehyde |
IUPAC Name: | 2-bromo-3-fluoro-6-methoxybenzaldehyde |
Description: | 2-Bromo-3-fluoro-6-methoxybenzaldehyde (CAS# 1780200-30-7 ) is a useful research chemical. |
Molecular Weight: | 233.03 |
Molecular Formula: | C8H6BrFO2 |
Canonical SMILES: | COC1=C(C(=C(C=C1)F)Br)C=O |
InChI: | InChI=1S/C8H6BrFO2/c1-12-7-3-2-6(10)8(9)5(7)4-11/h2-4H,1H3 |
InChI Key: | JZGANHGCQQLIPV-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
CN-112409385-A | Azaaryl compounds and uses thereof | 20190822 |
WO-2021032004-A1 | Azaheteroaryl compound and application thereof | 20190822 |
WO-2021032004-A9 | Azaheteroaryl compound and application thereof | 20190822 |
US-2019382398-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20180613 |
WO-2019241533-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20180613 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 231.95352 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 231.95352 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS