2-Bromo-3,5-dimethylthiophene - CAS 172319-76-5
Catalog: |
BB012815 |
Product Name: |
2-Bromo-3,5-dimethylthiophene |
CAS: |
172319-76-5 |
Synonyms: |
2-bromo-3,5-dimethylthiophene |
IUPAC Name: | 2-bromo-3,5-dimethylthiophene |
Description: | 2-Bromo-3,5-dimethylthiophene (CAS# 172319-76-5) is a useful research chemical compound. |
Molecular Weight: | 191.09 |
Molecular Formula: | C6H7BrS |
Canonical SMILES: | CC1=CC(=C(S1)Br)C |
InChI: | InChI=1S/C6H7BrS/c1-4-3-5(2)8-6(4)7/h3H,1-2H3 |
InChI Key: | RKANUDQVJZLGOO-UHFFFAOYSA-N |
LogP: | 3.12740 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P302+P352, P321, P330, P332+P313, P362, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2014029014-A1 | Thieno, furo and selenopheno-[3,4-c]pyrrole-4,6-dione copolymers | 20120820 |
EP-2632269-A1 | Cyclic amine substituted oxazolidinone cetp inhibitor | 20101029 |
WO-2012058187-A1 | Cyclic amine substituted oxazolidinone cetp inhibitor | 20101029 |
US-2011245239-A1 | Organic compounds | 20081219 |
US-2013131053-A1 | Isoxazoline derivatives as pesticides | 20081219 |
Complexity: | 84.6 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.94518 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.94518 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Thiophenes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS