2-Aminopyrazolo[1,5-a]pyridine - CAS 51119-05-2
Catalog: |
BB027336 |
Product Name: |
2-Aminopyrazolo[1,5-a]pyridine |
CAS: |
51119-05-2 |
Synonyms: |
2-pyrazolo[1,5-a]pyridinamine; pyrazolo[1,5-a]pyridin-2-amine |
IUPAC Name: | pyrazolo[1,5-a]pyridin-2-amine |
Description: | 2-Aminopyrazolo[1,5-a]pyridine (CAS# 51119-05-2) is a useful research chemical. |
Molecular Weight: | 133.15 |
Molecular Formula: | C7H7N3 |
Canonical SMILES: | C1=CC2=CC(=NN2C=C1)N |
InChI: | InChI=1S/C7H7N3/c8-7-5-6-3-1-2-4-10(6)9-7/h1-5H,(H2,8,9) |
InChI Key: | GHTCDIMLJVTPEP-UHFFFAOYSA-N |
LogP: | 1.49770 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021164746-A1 | Substituted aryl compound | 20200219 |
CN-110818683-A | 2-pyridine substituted urea structure small molecule compound and synthesis and application thereof | 20180810 |
EP-3643703-A1 | Ep300/crebbp inhibitor | 20170621 |
JP-WO2018235966-A1 | EP300 / CREBBP inhibitor | 20170621 |
TW-201906838-A | EP300/CREBBP inhibitor | 20170621 |
Complexity: | 126 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 133.063997236 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 133.063997236 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 43.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS