2-(Aminomethyl)-4-methoxypyridine - CAS 194658-14-5
Catalog: |
BB015071 |
Product Name: |
2-(Aminomethyl)-4-methoxypyridine |
CAS: |
194658-14-5 |
Synonyms: |
(4-methoxy-2-pyridinyl)methanamine; (4-methoxypyridin-2-yl)methanamine |
IUPAC Name: | (4-methoxypyridin-2-yl)methanamine |
Description: | 2-(Aminomethyl)-4-methoxypyridine (CAS# 194658-14-5) is a useful research chemical. |
Molecular Weight: | 138.17 |
Molecular Formula: | C7H10N2O |
Canonical SMILES: | COC1=CC(=NC=C1)CN |
InChI: | InChI=1S/C7H10N2O/c1-10-7-2-3-9-6(4-7)5-8/h2-4H,5,8H2,1H3 |
InChI Key: | SGKAHGGNLZRWQM-UHFFFAOYSA-N |
Boiling Point: | 242.851 ℃ at 760 mmHg |
Density: | 1.091 g/cm3 |
MDL: | MFCD11111886 |
LogP: | 1.24920 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
JP-2021042188-A | Dinuclearization ligand or dinuclear metal complex | 20190913 |
WO-2020247679-A1 | Wdr5 inhibitors and modulators | 20190604 |
WO-2020086857-A1 | Wdr5 inhibitors and modulators | 20181024 |
EP-3870173-A1 | Wdr5 inhibitors and modulators | 20181024 |
US-2020055824-A1 | Wdr5-mll1 inhibitors and modulators | 20180816 |
Complexity: | 97.6 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 138.079312947 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 138.079312947 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 48.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS