2-amino-N-(2-hydroxyethyl)acetamide - CAS 75007-28-2
Catalog: |
BB061490 |
Product Name: |
2-amino-N-(2-hydroxyethyl)acetamide |
CAS: |
75007-28-2 |
Synonyms: |
2-amino-N-(2-hydroxyethyl)acetamide; Acetamide, 2-amino-N-(2-hydroxyethyl)-; N-(2-Hydroxyethyl)glycinamide |
IUPAC Name: | 2-amino-N-(2-hydroxyethyl)acetamide |
Description: | 2-amino-N-(2-hydroxyethyl)acetamide (cas# 75007-28-2) is a useful research chemical. |
Molecular Weight: | 118.13 |
Molecular Formula: | C4H10N2O2 |
Canonical SMILES: | C(CO)NC(=O)CN |
InChI: | InChI=1S/C4H10N2O2/c5-3-4(8)6-1-2-7/h7H,1-3,5H2,(H,6,8) |
InChI Key: | XGBMKOJOGRVLNT-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021060395-A1 | Sustained-release pharmaceutical composition | 20190925 |
WO-2019182015-A1 | Alginic acid derivative bonded to nonsteroidal anti-inflammatory compound | 20180322 |
CN-112154158-A | Alginic acid derivatives with non-steroidal anti-inflammatory compounds attached | 20180322 |
JP-WO2019182015-A1 | Non-steroidal anti-inflammatory compound bound alginate derivative | 20180322 |
WO-2019126353-A2 | Compositions and methods for the treatment of bacterial infections | 20171220 |
EP-3504185-A1 | Novel substituted n'-hydroxycarbamimidoyl-1,2,5-oxadiazole compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20160829 |
WO-2018044663-A1 | Novel substituted n'-hydroxycarbamimidoyl-1,2,5-oxadiazole compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20160829 |
US-2020231606-A1 | Novel substituted n'-hydroxycarbamimidoyl-1,2,5-oxadiazole compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20160829 |
US-10988487-B2 | Substituted n′-hydroxycarbamimidoyl-1,2,5-oxadiazole compounds as indoleamine 2,3-dioxygenase (IDO) inhibitors | 20160829 |
EP-3504185-B1 | Novel substituted n'-hydroxycarbamimidoyl-1,2,5-oxadiazole compounds as indoleamine 2,3-dioxygenase (ido) inhibitors | 20160829 |
Complexity: | 74.4 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 118.074227566 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 118.074227566 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 75.4Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS