2-Amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide Dihydrochloride - CAS 1219957-57-9
Catalog: |
BB005319 |
Product Name: |
2-Amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide Dihydrochloride |
CAS: |
1219957-57-9 |
Synonyms: |
2-amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide;dihydrochloride; 2-amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide;dihydrochloride |
IUPAC Name: | 2-amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide;dihydrochloride |
Description: | 2-Amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide Dihydrochloride (CAS# 1219957-57-9) is a useful research chemical compound. |
Molecular Weight: | 246.18 |
Molecular Formula: | C8H21Cl2N3O |
Canonical SMILES: | CC(C)(C(=O)NCCN(C)C)N.Cl.Cl |
InChI: | InChI=1S/C8H19N3O.2ClH/c1-8(2,9)7(12)10-5-6-11(3)4;;/h5-6,9H2,1-4H3,(H,10,12);2*1H |
InChI Key: | LCVDMJHIUWFVFH-UHFFFAOYSA-N |
Storage: | Inert atmosphere, Room Temperature |
MDL: | MFCD13562564 |
LogP: | 2.09670 |
Publication Number | Title | Priority Date |
CN-112209908-A | Glucopyranosyl derivative and use thereof | 20190710 |
WO-2021004498-A1 | Glucopyranosyl derivatives and their uses | 20190710 |
WO-2019144864-A1 | Glucopyranosyl derivative and use thereof | 20180123 |
AU-2019211664-A1 | Glucopyranosyl derivative and use thereof | 20180123 |
EP-3743412-A1 | Glucopyranosyl derivative and use thereof | 20180123 |
Complexity: | 154 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 3 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 245.1061677 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 4 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 245.1061677 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 58.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS