2-amino-6-hydroxy-5-isopropylpyrimidin-4(3H)-one - CAS 500161-23-9
Catalog: |
BB026891 |
Product Name: |
2-amino-6-hydroxy-5-isopropylpyrimidin-4(3H)-one |
CAS: |
500161-23-9 |
Synonyms: |
2-amino-4-hydroxy-5-propan-2-yl-1H-pyrimidin-6-one; 2-amino-4-hydroxy-5-propan-2-yl-1H-pyrimidin-6-one |
IUPAC Name: | 2-amino-4-hydroxy-5-propan-2-yl-1H-pyrimidin-6-one |
Description: | 2-amino-6-hydroxy-5-isopropylpyrimidin-4(3H)-one (CAS# 500161-23-9 ) is a useful research chemical. |
Molecular Weight: | 169.18 |
Molecular Formula: | C7H11N3O2 |
Canonical SMILES: | CC(C)C1=C(N=C(NC1=O)N)O |
InChI: | InChI=1S/C7H11N3O2/c1-3(2)4-5(11)9-7(8)10-6(4)12/h3H,1-2H3,(H4,8,9,10,11,12) |
InChI Key: | GWBXUTJCYUUSDY-UHFFFAOYSA-N |
Boiling Point: | 430.8 ℃ at 760 mmHg |
Density: | 1.352 g/cm3 |
LogP: | 0.35960 |
Publication Number | Title | Priority Date |
US-2017267681-A1 | Antiviral azasugar-containing nucleosides | 20121116 |
CZ-2011103-A3 | Pyrimidine compounds inhibiting formation of nitrogen monoxide and prostaglandin E2, preparation process and use thereof | 20110228 |
CZ-305457-B6 | Pyrimidine compounds inhibiting formation of nitrogen monoxide and prostaglandin E2, process for their preparation and use | 20110228 |
EP-2680847-A1 | Pyrimidine compounds inhibiting the formation of nitric oxide and prostaglandin e2, method of production thereof and use thereof | 20110228 |
EP-3195867-A1 | Pyrimidine compounds inhibiting the formation of nitric oxide and prostaglandin e2, method of production thereof and use thereof | 20110228 |
Complexity: | 278 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 169.085126602 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 169.085126602 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 87.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[72607-53-5]
N-(3-Aminopropyl)methacrylamide Hydrochloride
-
[16208-48-3]
Ethanesulfonic acid, 2,2'-trithiodi-, disodium salt
-
[14245-62-6]
Isopropyl ethanesulfonate
-
[10128-55-9]
N-[2-(4-oxo-4H-3,1-benzoxazin-2-yl)phenyl]-2-naphthalenesulfonamide
-
[79551-14-7]
Ferene Disodium Salt
INDUSTRY LEADERS TRUST OUR PRODUCTS