2-Amino-6-chloroquinazoline - CAS 20028-71-1
Catalog: |
BB015462 |
Product Name: |
2-Amino-6-chloroquinazoline |
CAS: |
20028-71-1 |
Synonyms: |
6-chloro-2-quinazolinamine; 6-chloroquinazolin-2-amine |
IUPAC Name: | 6-chloroquinazolin-2-amine |
Description: | 2-Amino-6-chloroquinazoline (CAS# 20028-71-1) is a useful research chemical. |
Molecular Weight: | 179.61 |
Molecular Formula: | C8H6ClN3 |
Canonical SMILES: | C1=CC2=NC(=NC=C2C=C1Cl)N |
InChI: | InChI=1S/C8H6ClN3/c9-6-1-2-7-5(3-6)4-11-8(10)12-7/h1-4H,(H2,10,11,12) |
InChI Key: | RHALXGOIIIEADC-UHFFFAOYSA-N |
Boiling Point: | 403.4 °C at 760 mmHg |
Density: | 1.445 g/cm3 |
LogP: | 2.44660 |
Publication Number | Title | Priority Date |
AU-2016340798-A1 | Aminoisoxazoline compounds as agonists of alpha7-nicotinic acetylcholine receptors | 20151020 |
CA-3002801-A1 | Aminoisoxazoline compounds as agonists of alpha7-nicotinic acetylcholine receptors | 20151020 |
EP-3365061-A1 | Aminoisoxazoline compounds as agonists of alpha7-nicotinic acetylcholine receptors | 20151020 |
JP-2018531262-A | Aminoisoxazoline compounds as agonists of α7-nicotinic acetylcholine receptors | 20151020 |
US-2017247393-A1 | Aminoisoxazoline Compounds as Agonists of Alpha7-Nicotinic Acetylcholine Receptors | 20151020 |
Complexity: | 164 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 179.0250249 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 179.0250249 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 51.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS