2-Amino-6-bromo-3-methoxybenzoic Acid - CAS 67303-48-4
Catalog: |
BB033242 |
Product Name: |
2-Amino-6-bromo-3-methoxybenzoic Acid |
CAS: |
67303-48-4 |
Synonyms: |
2-amino-6-bromo-3-methoxybenzoic acid; 2-amino-6-bromo-3-methoxybenzoic acid |
IUPAC Name: | 2-amino-6-bromo-3-methoxybenzoic acid |
Description: | 2-Amino-6-bromo-3-methoxybenzoic Acid (CAS# 67303-48-4) is a useful research chemical. |
Molecular Weight: | 246.06 |
Molecular Formula: | C8H8BrNO3 |
Canonical SMILES: | COC1=C(C(=C(C=C1)Br)C(=O)O)N |
InChI: | InChI=1S/C8H8BrNO3/c1-13-5-3-2-4(9)6(7(5)10)8(11)12/h2-3H,10H2,1H3,(H,11,12) |
InChI Key: | HMCXJHVLOBBQJV-UHFFFAOYSA-N |
LogP: | 2.31930 |
Publication Number | Title | Priority Date |
CA-3033370-A1 | Certain chemical entities, compositions, and methods | 20160815 |
EP-3497087-A1 | Certain chemical entities, compositions, and methods | 20160815 |
JP-2019526550-A | Specific chemical entities, compositions and methods | 20160815 |
US-10544106-B2 | Certain chemical entities, compositions, and methods | 20160815 |
US-2018072688-A1 | Certain chemical entities, compositions, and methods | 20160815 |
Complexity: | 200 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 244.96876 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 244.96876 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 72.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS