2-Amino-6-benzyloxypyridine - CAS 1174626-28-8
Catalog: |
BB061298 |
Product Name: |
2-Amino-6-benzyloxypyridine |
CAS: |
1174626-28-8 |
Synonyms: |
6-(Phenylmethoxy)-2-pyridinamine |
IUPAC Name: | 6-phenylmethoxypyridin-2-amine |
Description: | 2-Amino-6-benzyloxypyridine |
Molecular Weight: | 200.24 |
Molecular Formula: | C12H12N2O |
Canonical SMILES: | C1=CC=C(C=C1)COC2=CC=CC(=N2)N |
InChI: | InChI=1S/C12H12N2O/c13-11-7-4-8-12(14-11)15-9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,13,14) |
InChI Key: | MEPQJQHIUFFWMI-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
KR-20210035059-A | Compound as p62 ligand, composition for preventing, improving or treating proteinopathies comprising the same | 20190920 |
WO-2021054804-A1 | Novel p62 ligand compound, and composition containing same for preventing, ameliorating, or treating proteinopathies | 20190920 |
US-10398783-B2 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
US-2018110873-A1 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
US-2019358339-A1 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
WO-2018075842-A1 | Condensed benzodiazepine derivatives and conjugates made therefrom | 20161020 |
US-10869934-B2 | Antiproliferative compounds and conjugates made therefrom | 20161020 |
CN-103130686-A | N,N'-asymmetric diayl substitution urea compound and preparation method and purpose thereof | 20111202 |
CN-103130686-B | N, N '-asymmetric diaryl substitute urea compound and its production and use | 20111202 |
CN-103298791-A | Viral polymerase inhibitors | 20101020 |
Complexity: | 181 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 200.094963011 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 200.094963011 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 48.1Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
-
[3553-80-8]
Ethyl diethylcarbamate
-
[56507-37-0]
Metribuzin-diketo
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[63528-29-0]
Ethyl(2-methylpropyl)amine hydrochloride
-
[2555-49-9]
Ethyl phenoxyacetate
-
[891016-02-7]
ML-SI3
INDUSTRY LEADERS TRUST OUR PRODUCTS