2-Amino-5-morpholinobenzoic Acid - CAS 153437-52-6
Catalog: |
BB010901 |
Product Name: |
2-Amino-5-morpholinobenzoic Acid |
CAS: |
153437-52-6 |
Synonyms: |
2-amino-5-(4-morpholinyl)benzoic acid; 2-amino-5-morpholin-4-ylbenzoic acid |
IUPAC Name: | 2-amino-5-morpholin-4-ylbenzoic acid |
Description: | 2-Amino-5-morpholinobenzoic Acid (CAS# 153437-52-6) is a useful research chemical. |
Molecular Weight: | 222.24 |
Molecular Formula: | C11H14N2O3 |
Canonical SMILES: | C1COCCN1C2=CC(=C(C=C2)N)C(=O)O |
InChI: | InChI=1S/C11H14N2O3/c12-10-2-1-8(7-9(10)11(14)15)13-3-5-16-6-4-13/h1-2,7H,3-6,12H2,(H,14,15) |
InChI Key: | HFHMPAKMODSNJN-UHFFFAOYSA-N |
LogP: | 1.44980 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2004259127-A1 | Aminoquinoline derivatives and their use as adenosine A3 ligands | 20030731 |
AU-2004259127-B2 | Aminoquinoline derivatives and their use as adenosine A3 ligands | 20030731 |
CA-2534105-C | Aminoquinoline derivatives and their use as adenosine a3 ligands | 20030731 |
CN-100402501-C | Aminoquinoline derivatives and their use as adenosine A3 ligands | 20030731 |
CN-101239945-A | Aminoquinoline derivatives and their use as adenosine a3 ligands | 20030731 |
Complexity: | 254 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 222.10044231 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 222.10044231 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 75.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS