2-amino-5-chloroquinazoline - CAS 190273-70-2
Catalog: |
BB014704 |
Product Name: |
2-amino-5-chloroquinazoline |
CAS: |
190273-70-2 |
Synonyms: |
5-chloro-2-quinazolinamine; 5-chloroquinazolin-2-amine |
IUPAC Name: | 5-chloroquinazolin-2-amine |
Description: | 2-amino-5-chloroquinazoline (CAS# 190273-70-2) is a useful research chemical. |
Molecular Weight: | 179.61 |
Molecular Formula: | C8H6ClN3 |
Canonical SMILES: | C1=CC2=NC(=NC=C2C(=C1)Cl)N |
InChI: | InChI=1S/C8H6ClN3/c9-6-2-1-3-7-5(6)4-11-8(10)12-7/h1-4H,(H2,10,11,12) |
InChI Key: | NUJGYORYWLHYGS-UHFFFAOYSA-N |
Boiling Point: | 403.4 ℃ at 760 mmHg |
Melting Point: | 249-252 ℃ |
Purity: | 95 % |
Density: | 1.445 g/cm3 |
MDL: | MFCD00974335 |
LogP: | 2.44660 |
Publication Number | Title | Priority Date |
CN-106316965-A | Quinazoline compound and its intermediate, preparation method, pharmaceutical composition and use | 20150703 |
WO-2017005137-A1 | Quinazoline compound, intermediate, preparation method, pharmaceutical composition and uses thereof | 20150703 |
CN-106316965-B | Quinazoline compound, intermediate thereof, preparation method, pharmaceutical composition and application | 20150703 |
JP-2014156472-A | Quinuclidine compounds as α7 nicotinic acetylcholine receptor ligands | 20140428 |
JP-5714745-B2 | Quinuclidine compounds as α7 nicotinic acetylcholine receptor ligands | 20140428 |
Complexity: | 164 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 179.0250249 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 179.0250249 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 51.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS