2-Amino-5-chlorobenzothiazole - CAS 20358-00-3
Catalog: |
BB015833 |
Product Name: |
2-Amino-5-chlorobenzothiazole |
CAS: |
20358-00-3 |
Synonyms: |
5-chloro-1,3-benzothiazol-2-amine; 5-chloro-1,3-benzothiazol-2-amine |
IUPAC Name: | 5-chloro-1,3-benzothiazol-2-amine |
Description: | 2-Amino-5-chlorobenzothiazole (CAS# 20358-00-3) is a useful research chemical, an aminobenzothiazolamine derivative with anti-inflammatory activity. |
Molecular Weight: | 184.65 |
Molecular Formula: | C7H5ClN2S |
Canonical SMILES: | C1=CC2=C(C=C1Cl)N=C(S2)N |
InChI: | InChI=1S/C7H5ClN2S/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H,(H2,9,10) |
InChI Key: | AVVSRALHGMVQQW-UHFFFAOYSA-N |
Boiling Point: | 344.3 °C at 760 mmHg |
Density: | 1.532 g/cm3 |
MDL: | MFCD00205355 |
LogP: | 3.11310 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-212524102-U | Bromine oxidation reaction production system | 20200615 |
WO-2021101927-A1 | Wdr5-myc inhibitors | 20191118 |
EP-3901139-A1 | Novel hydrazone derivative with aryl or heteroaryl group substituted at terminal amine group thereof and use thereof | 20181219 |
WO-2019169158-A1 | Novel antimycobacterial heterocyclic amides | 20180228 |
CN-112423746-A | Novel anti-mycobacterial heterocyclic amides | 20180228 |
Complexity: | 155 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 183.9861970 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 183.9861970 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 67.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS