2-Amino-5-chloro-6-methylpyridine - CAS 36936-23-9
Catalog: |
BB023140 |
Product Name: |
2-Amino-5-chloro-6-methylpyridine |
CAS: |
36936-23-9 |
Synonyms: |
5-chloro-6-methylpyridin-2-amine |
IUPAC Name: | 5-chloro-6-methylpyridin-2-amine |
Description: | 2-Amino-5-chloro-6-methylpyridine (CAS# 36936-23-9) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 142.59 |
Molecular Formula: | C6H7ClN2 |
Canonical SMILES: | CC1=C(C=CC(=N1)N)Cl |
InChI: | InChI=1S/C6H7ClN2/c1-4-5(7)2-3-6(8)9-4/h2-3H,1H3,(H2,8,9) |
InChI Key: | SHIKRPPKGCWKJO-UHFFFAOYSA-N |
Boiling Point: | 234.191 °C at 760 mmHg |
Purity: | 96 % |
Density: | 1.26 g/cm3 |
MDL: | MFCD09453335 |
LogP: | 2.20680 |
GHS Hazard Statement: | H302 (97.5%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P310, P330, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020037155-A1 | 1,3,4,9-tetrahydro-2h-pyrido[3,4-b]indole derivative compounds and uses thereof | 20180816 |
CN-112654354-A | 1,3,4, 9-tetrahydro-2H-pyrido [3,4-b ] indole derivative compound and application thereof | 20180816 |
EP-3836919-A1 | 1,3,4,9-tetrahydro-2h-pyrido[3,4-b]indole derivative compounds and uses thereof | 20180816 |
US-2021163479-A1 | 1,3,4,9-tetrahydro-2h-pyrido[3,4-b]indole derivative compounds and uses thereof | 20180816 |
TW-202003513-A | Inhibitors of plasma kallikrein and uses thereof | 20180313 |
Complexity: | 97.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 142.0297759 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 142.0297759 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS