2-Amino-5-bromo-6-methylpyrazine - CAS 74290-69-0
Catalog: |
BB035048 |
Product Name: |
2-Amino-5-bromo-6-methylpyrazine |
CAS: |
74290-69-0 |
Synonyms: |
5-bromo-6-methyl-2-pyrazinamine; 5-bromo-6-methylpyrazin-2-amine |
IUPAC Name: | 5-bromo-6-methylpyrazin-2-amine |
Description: | 2-Amino-5-bromo-6-methylpyrazine (CAS# 74290-69-0) is a useful research chemical. |
Molecular Weight: | 188.03 |
Molecular Formula: | C5H6BrN3 |
Canonical SMILES: | CC1=NC(=CN=C1Br)N |
InChI: | InChI=1S/C5H6BrN3/c1-3-5(6)8-2-4(7)9-3/h2H,1H3,(H2,7,9) |
InChI Key: | YNMLUNRXLAUIDA-UHFFFAOYSA-N |
Boiling Point: | 273.775 ℃ at 760 mmHg |
Density: | 1.7 g/cm3 |
MDL: | MFCD08705763 |
LogP: | 1.71090 |
Publication Number | Title | Priority Date |
WO-2020106558-A1 | Substituted amino triazolopyrimidine and amino triazolopyrazine adenosine receptor antagonists, pharmaceutical compositions and their use | 20181120 |
CN-113015530-A | Substituted aminotriazolopyrimidines and aminotriazolopyrizine adenosine receptor antagonists, pharmaceutical compositions and uses thereof | 20181120 |
EP-3883575-A1 | Substituted amino triazolopyrimidine and amino triazolopyrazine adenosine receptor antagonists, pharmaceutical compositions and their use | 20181120 |
KR-20210093964-A | Substituted amino triazolopyrimidine and amino triazolopyrazine adenosine receptor antagonists, pharmaceutical compositions and uses thereof | 20181120 |
WO-2019099315-A1 | Antidiabetic bicyclic compounds | 20171116 |
Complexity: | 98.2 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.97451 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.97451 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 51.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyrazines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS