(2-Amino-4-thiazolyl)methanol - CAS 51307-43-8
Catalog: |
BB027401 |
Product Name: |
(2-Amino-4-thiazolyl)methanol |
CAS: |
51307-43-8 |
Synonyms: |
(2-amino-4-thiazolyl)methanol; (2-amino-1,3-thiazol-4-yl)methanol |
IUPAC Name: | (2-amino-1,3-thiazol-4-yl)methanol |
Description: | (2-Amino-4-thiazolyl)methanol (CAS# 51307-43-8) is a compound useful in organic synthesis. |
Molecular Weight: | 130.17 |
Molecular Formula: | C4H6N2OS |
Canonical SMILES: | C1=C(N=C(S1)N)CO |
InChI: | InChI=1S/C4H6N2OS/c5-4-6-3(1-7)2-8-4/h2,7H,1H2,(H2,5,6) |
InChI Key: | FNXARVNPSVMCEY-UHFFFAOYSA-N |
Boiling Point: | 340.738 °C at 760 mmHg |
Density: | 1.475 g/cm3 |
MDL: | MFCD08275702 |
LogP: | 0.79880 |
Publication Number | Title | Priority Date |
WO-2020107335-A1 | Crystalline salts of corydalmine | 20181129 |
WO-2020108330-A1 | Crystalline salts of corydalmine | 20181129 |
CN-111788201-A | Crystalline salts of corydalmine | 20181129 |
EP-3887367-A1 | Crystalline salts of corydalmine | 20181129 |
AU-2018352160-A1 | Benzimidazole compounds as agricultural chemicals | 20171018 |
PMID | Publication Date | Title | Journal |
18256725 | 20070101 | Organosilicon-containing thiazole derivatives as potential lipoxygenase inhibitors and anti-inflammatory agents | Bioinorganic chemistry and applications |
Complexity: | 80.4 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 130.02008399 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 130.02008399 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 87.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS