2-Amino-4-pyridinylmethanol - CAS 105250-17-7
Catalog: |
BB001588 |
Product Name: |
2-Amino-4-pyridinylmethanol |
CAS: |
105250-17-7 |
Synonyms: |
(2-aminopyridin-4-yl)methanol |
IUPAC Name: | (2-aminopyridin-4-yl)methanol |
Description: | 2-Amino-4-pyridinylmethanol (CAS# 105250-17-7) is a useful pharmaceutical intermediate. |
Molecular Weight: | 124.14 |
Molecular Formula: | C6H8N2O |
Canonical SMILES: | C1=CN=C(C=C1CO)N |
InChI: | InChI=1S/C6H8N2O/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2,(H2,7,8) |
InChI Key: | ZRJJXXDQIQFZBW-UHFFFAOYSA-N |
Boiling Point: | 329.5 °C |
Density: | 1.257 g/cm3 |
MDL: | MFCD03791261 |
LogP: | 0.73730 |
GHS Hazard Statement: | H302 (82.98%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021161105-A1 | P2x3 modulators | 20200214 |
WO-2021149776-A1 | Arylamide derivative having antitumor activity | 20200122 |
WO-2021032148-A1 | Aminopyrazine compounds as hpk1 inhibitor and the use thereof | 20190821 |
US-2020231591-A1 | Fused ring heteroaryl compounds as alk4/5 inhibitors | 20190122 |
WO-2020153676-A1 | A fused ring heteroaryl compound as an alk4/5 inhibitor | 20190122 |
Complexity: | 87.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 124.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 124.063662883 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 59.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS